About (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate
(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate (PubChem CID 20692273) has the molecular formula C10H17O3S-
and a molecular weight of 217.31 g/mol. Its IUPAC name is (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate.
Molecular Properties
| Compound Name | (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate |
| PubChem CID | 20692273 |
| Molecular Formula | C10H17O3S- |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate |
| SMILES | CC1=C(CS(=O)[O-])C(C)(C)CCC1O |
| InChI | InChI=1S/C10H18O3S/c1-7-8(6-14(12)13)10(2,3)5-4-9(7)11/h9,11H,4-6H2,1-3H3,(H,12,13)/p-1 |
| InChIKey | WWELKRBPAMZNBE-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
The IUPAC name of (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate (CID 20692273) is (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate.
What is the SMILES notation for (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
The canonical SMILES for (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate is CC1=C(CS(=O)[O-])C(C)(C)CCC1O.
What is the InChIKey of (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
The InChIKey is WWELKRBPAMZNBE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O3S/c1-7-8(6-14(12)13)10(2,3)5-4-9(7)11/h9,11H,4-6H2,1-3H3,(H,12,13)/p-1.
What are the key properties of (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate?
(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate has a molecular weight of 217.31 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)methanesulfinate is sourced from PubChem (CID 20692273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).