C15H22O4 — CID 20692402
3-[6-(1-hydroxyethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione (PubChem CID 20692402) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[6-(1-hydroxyethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[6-(1-hydroxyethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 20692402 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-[6-(1-hydroxyethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
| SMILES | CC(O)C1CC2CC1C(C1C(=O)OC(=O)C1C)C2C |
| InChI | InChI=1S/C15H22O4/c1-6-9-4-10(8(3)16)11(5-9)12(6)13-7(2)14(17)19-15(13)18/h6-13,16H,4-5H2,1-3H3 |
| InChIKey | VTUXPLFWLASPCG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|