3,6-dihydro-2H-pyran-2-ylmethyl acetate

C8H12O3 — CID 20692459

IUPAC3,6-dihydro-2H-pyran-2-ylmethyl acetate
SMILESCC(=O)OCC1CC=CCO1
InChIInChI=1S/C8H12O3/c1-7(9)11-6-8-4-2-3-5-10-8/h2-3,8H,4-6H2,1H3
InChIKeyGVZGIPMXJHZGDI-UHFFFAOYSA-N
MW156.18 g/mol
LogP0.89
Rot. Bonds2

About 3,6-dihydro-2H-pyran-2-ylmethyl acetate

3,6-dihydro-2H-pyran-2-ylmethyl acetate (PubChem CID 20692459) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyran-2-ylmethyl acetate.

Molecular Properties

Compound Name3,6-dihydro-2H-pyran-2-ylmethyl acetate
PubChem CID20692459
Molecular FormulaC8H12O3
Molecular Weight156.18 g/mol
Exact Mass156.08
IUPAC Name3,6-dihydro-2H-pyran-2-ylmethyl acetate
SMILESCC(=O)OCC1CC=CCO1
InChIInChI=1S/C8H12O3/c1-7(9)11-6-8-4-2-3-5-10-8/h2-3,8H,4-6H2,1H3
InChIKeyGVZGIPMXJHZGDI-UHFFFAOYSA-N
XLogP0.89
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.18
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,6-dihydro-2H-pyran-2-ylmethyl acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,6-dihydro-2H-pyran-2-ylmethyl acetate?
The IUPAC name of 3,6-dihydro-2H-pyran-2-ylmethyl acetate (CID 20692459) is 3,6-dihydro-2H-pyran-2-ylmethyl acetate.
What is the SMILES notation for 3,6-dihydro-2H-pyran-2-ylmethyl acetate?
The canonical SMILES for 3,6-dihydro-2H-pyran-2-ylmethyl acetate is CC(=O)OCC1CC=CCO1.
What is the InChIKey of 3,6-dihydro-2H-pyran-2-ylmethyl acetate?
The InChIKey is GVZGIPMXJHZGDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-7(9)11-6-8-4-2-3-5-10-8/h2-3,8H,4-6H2,1H3.
What are the key properties of 3,6-dihydro-2H-pyran-2-ylmethyl acetate?
3,6-dihydro-2H-pyran-2-ylmethyl acetate has a molecular weight of 156.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-2H-pyran-2-ylmethyl acetate is sourced from PubChem (CID 20692459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).