C27H25ClN2O2 — CID 20692639
(4-methylphenyl) 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (PubChem CID 20692639) has the molecular formula C27H25ClN2O2 and a molecular weight of 444.96 g/mol. Its IUPAC name is (4-methylphenyl) 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate.
| Compound Name | (4-methylphenyl) 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20692639 |
| Molecular Formula | C27H25ClN2O2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (4-methylphenyl) 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C27H25ClN2O2/c1-18-4-9-23(10-5-18)32-27(31)30-15-12-19(13-16-30)25-24-11-8-22(28)17-21(24)7-6-20-3-2-14-29-26(20)25/h2-5,8-11,14,17H,6-7,12-13,15-16H2,1H3 |
| InChIKey | HCANBDGFCVDRFK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |