C35H36F2N5O3S+ — CID 20692802
aminomethylidene-[(4-butanoyloxy-3,5-dimethylphenyl)methyl]-[[3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]iminomethyl]azanium (PubChem CID 20692802) has the molecular formula C35H36F2N5O3S+ and a molecular weight of 644.77 g/mol. Its IUPAC name is aminomethylidene-[(4-butanoyloxy-3,5-dimethylphenyl)methyl]-[[3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]iminomethyl]azanium.
| Compound Name | aminomethylidene-[(4-butanoyloxy-3,5-dimethylphenyl)methyl]-[[3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]iminomethyl]azanium |
|---|---|
| PubChem CID | 20692802 |
| Molecular Formula | C35H36F2N5O3S+ |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | aminomethylidene-[(4-butanoyloxy-3,5-dimethylphenyl)methyl]-[[3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,5-difluorophenyl)-2-hydroxybutyl]iminomethyl]azanium |
| SMILES | CCCC(=O)Oc1c(C)cc(C[N+](=C/N)/C=N/CC(O)(c2cc(F)ccc2F)C(C)c2nc(-c3ccc(C#N)cc3)cs2)cc1C |
| InChI | InChI=1S/C35H35F2N5O3S/c1-5-6-32(43)45-33-22(2)13-26(14-23(33)3)17-42(20-39)21-40-19-35(44,29-15-28(36)11-12-30(29)37)24(4)34-41-31(18-46-34)27-9-7-25(16-38)8-10-27/h7-15,18,20-21,24,39,44H,5-6,17,19H2,1-4H3/p+1/b40-21+ |
| InChIKey | GIPXDYBISSHMJZ-VQWGYEAZSA-O |
| XLogP | 6.50 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|