About (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate
(5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate (PubChem CID 20693246) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate.
Analyze (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate?
The IUPAC name of (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate (CID 20693246) is (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate.
What is the SMILES notation for (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate?
The canonical SMILES for (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate is CCC1(COC(=O)OC)COC(C)(C)OC1.
What is the InChIKey of (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate?
The InChIKey is GNSHWSHGERPLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-5-11(6-14-9(12)13-4)7-15-10(2,3)16-8-11/h5-8H2,1-4H3.
What are the key properties of (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate?
(5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate has a molecular weight of 232.28 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2,2-dimethyl-1,3-dioxan-5-yl)methyl methyl carbonate is sourced from PubChem (CID 20693246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).