About 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide
2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide (PubChem CID 20693305) has the molecular formula C10H15N3O5
and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide |
| PubChem CID | 20693305 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide |
| SMILES | NC(=O)C(CC(=O)NCCO)N1C(=O)CCC1=O |
| InChI | InChI=1S/C10H15N3O5/c11-10(18)6(5-7(15)12-3-4-14)13-8(16)1-2-9(13)17/h6,14H,1-5H2,(H2,11,18)(H,12,15) |
| InChIKey | TUEOTPSLGQJZLT-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide?
The IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide (CID 20693305) is 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide.
What is the SMILES notation for 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide?
The canonical SMILES for 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide is NC(=O)C(CC(=O)NCCO)N1C(=O)CCC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide?
The InChIKey is TUEOTPSLGQJZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O5/c11-10(18)6(5-7(15)12-3-4-14)13-8(16)1-2-9(13)17/h6,14H,1-5H2,(H2,11,18)(H,12,15).
What are the key properties of 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide?
2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide has a molecular weight of 257.25 g/mol, XLogP of -2.51, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrolidin-1-yl)-N'-(2-hydroxyethyl)butanediamide is sourced from PubChem (CID 20693305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).