C28H26ClN7O2 — CID 20693587
6-chloro-2-N-[5-methoxy-6-[(2-methoxy-4,6-dimethylnaphthalen-1-yl)diazenyl]-7-methylnaphthalen-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 20693587) has the molecular formula C28H26ClN7O2 and a molecular weight of 528.02 g/mol. Its IUPAC name is 6-chloro-2-N-[5-methoxy-6-[(2-methoxy-4,6-dimethylnaphthalen-1-yl)diazenyl]-7-methylnaphthalen-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[5-methoxy-6-[(2-methoxy-4,6-dimethylnaphthalen-1-yl)diazenyl]-7-methylnaphthalen-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20693587 |
| Molecular Formula | C28H26ClN7O2 |
| Molecular Weight | 528.02 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 6-chloro-2-N-[5-methoxy-6-[(2-methoxy-4,6-dimethylnaphthalen-1-yl)diazenyl]-7-methylnaphthalen-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(C)c2cc(C)ccc2c1/N=N/c1c(C)cc2cc(Nc3nc(N)nc(Cl)n3)ccc2c1OC |
| InChI | InChI=1S/C28H26ClN7O2/c1-14-6-8-20-21(10-14)15(2)12-22(37-4)24(20)36-35-23-16(3)11-17-13-18(7-9-19(17)25(23)38-5)31-28-33-26(29)32-27(30)34-28/h6-13H,1-5H3,(H3,30,31,32,33,34)/b36-35+ |
| InChIKey | SLZTWVDCUXTXBX-ULDVOPSXSA-N |
| XLogP | 7.52 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.02 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|