C17H30O3 — CID 20693613
3-(2,4,6,8-tetramethylnonan-4-yl)oxolane-2,5-dione (PubChem CID 20693613) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 3-(2,4,6,8-tetramethylnonan-4-yl)oxolane-2,5-dione.
| Compound Name | 3-(2,4,6,8-tetramethylnonan-4-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 20693613 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 3-(2,4,6,8-tetramethylnonan-4-yl)oxolane-2,5-dione |
| SMILES | CC(C)CC(C)CC(C)(CC(C)C)C1CC(=O)OC1=O |
| InChI | InChI=1S/C17H30O3/c1-11(2)7-13(5)10-17(6,9-12(3)4)14-8-15(18)20-16(14)19/h11-14H,7-10H2,1-6H3 |
| InChIKey | LNAHWFIDOKKZLL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|