About N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide
N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide (PubChem CID 20693624) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide |
| PubChem CID | 20693624 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCN=C1C |
| InChI | InChI=1S/C8H15N3O/c1-7-9-3-5-11(7)6-4-10-8(2)12/h3-6H2,1-2H3,(H,10,12) |
| InChIKey | ZRCNHERMYSNAHV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide?
The IUPAC name of N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide (CID 20693624) is N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide is CC(=O)NCCN1CCN=C1C.
What is the InChIKey of N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide?
The InChIKey is ZRCNHERMYSNAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-7-9-3-5-11(7)6-4-10-8(2)12/h3-6H2,1-2H3,(H,10,12).
What are the key properties of N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide?
N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide has a molecular weight of 169.23 g/mol, XLogP of -0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-methyl-4,5-dihydroimidazol-1-yl)ethyl]acetamide is sourced from PubChem (CID 20693624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).