About 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole
2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 20693913) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole.
Analyze 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole?
The IUPAC name of 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole (CID 20693913) is 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole.
What is the SMILES notation for 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole?
The canonical SMILES for 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole is CC1=C(C)n2nc(C)nc2C1C.
What is the InChIKey of 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole?
The InChIKey is YQWNXBYLELQYHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-5-6(2)9-10-8(4)11-12(9)7(5)3/h6H,1-4H3.
What are the key properties of 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole?
2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole has a molecular weight of 163.22 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,6,7-tetramethyl-7H-pyrrolo[1,2-b][1,2,4]triazole is sourced from PubChem (CID 20693913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).