About N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide
N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 20694525) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| PubChem CID | 20694525 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC1=NOC(C(=O)NO)C1 |
| InChI | InChI=1S/C5H8N2O3/c1-3-2-4(10-7-3)5(8)6-9/h4,9H,2H2,1H3,(H,6,8) |
| InChIKey | KXINZOPDYGGIJM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The IUPAC name of N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide (CID 20694525) is N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide is CC1=NOC(C(=O)NO)C1.
What is the InChIKey of N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The InChIKey is KXINZOPDYGGIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3/c1-3-2-4(10-7-3)5(8)6-9/h4,9H,2H2,1H3,(H,6,8).
What are the key properties of N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide?
N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide has a molecular weight of 144.13 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-3-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 20694525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).