About 2-methylpropyl 2-(diethylamino)acetate
2-methylpropyl 2-(diethylamino)acetate (PubChem CID 20694675) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-methylpropyl 2-(diethylamino)acetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(diethylamino)acetate |
| PubChem CID | 20694675 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-methylpropyl 2-(diethylamino)acetate |
| SMILES | CCN(CC)CC(=O)OCC(C)C |
| InChI | InChI=1S/C10H21NO2/c1-5-11(6-2)7-10(12)13-8-9(3)4/h9H,5-8H2,1-4H3 |
| InChIKey | LJBLSSFHDFEIAU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl 2-(diethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(diethylamino)acetate?
The IUPAC name of 2-methylpropyl 2-(diethylamino)acetate (CID 20694675) is 2-methylpropyl 2-(diethylamino)acetate.
What is the SMILES notation for 2-methylpropyl 2-(diethylamino)acetate?
The canonical SMILES for 2-methylpropyl 2-(diethylamino)acetate is CCN(CC)CC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 2-(diethylamino)acetate?
The InChIKey is LJBLSSFHDFEIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-5-11(6-2)7-10(12)13-8-9(3)4/h9H,5-8H2,1-4H3.
What are the key properties of 2-methylpropyl 2-(diethylamino)acetate?
2-methylpropyl 2-(diethylamino)acetate has a molecular weight of 187.28 g/mol, XLogP of 1.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(diethylamino)acetate is sourced from PubChem (CID 20694675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).