C30H24N4O2 — CID 20694983
N-[4-[6-[(2-phenylcyclopropanecarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide (PubChem CID 20694983) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[4-[6-[(2-phenylcyclopropanecarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide.
| Compound Name | N-[4-[6-[(2-phenylcyclopropanecarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 20694983 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[4-[6-[(2-phenylcyclopropanecarbonyl)amino]-1H-benzimidazol-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccc(NC(=O)C4CC4c4ccccc4)cc3[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N4O2/c35-29(21-9-5-2-6-10-21)31-22-13-11-20(12-14-22)28-33-26-16-15-23(17-27(26)34-28)32-30(36)25-18-24(25)19-7-3-1-4-8-19/h1-17,24-25H,18H2,(H,31,35)(H,32,36)(H,33,34) |
| InChIKey | SAFOJGWPZQOZOJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |