4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid

C14H18O2 — CID 20695167

IUPAC4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid
SMILESCC1(C(=O)O)CC2CC1C1C3C=CC(C3)C21
InChIInChI=1S/C14H18O2/c1-14(13(15)16)6-9-5-10(14)12-8-3-2-7(4-8)11(9)12/h2-3,7-12H,4-6H2,1H3,(H,15,16)
InChIKeyYKBVEMNSTCWBNI-UHFFFAOYSA-N
MW218.30 g/mol
LogP2.56
Rot. Bonds1

About 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid

4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (PubChem CID 20695167) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.

Molecular Properties

Compound Name4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid
PubChem CID20695167
Molecular FormulaC14H18O2
Molecular Weight218.30 g/mol
Exact Mass218.13
IUPAC Name4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid
SMILESCC1(C(=O)O)CC2CC1C1C3C=CC(C3)C21
InChIInChI=1S/C14H18O2/c1-14(13(15)16)6-9-5-10(14)12-8-3-2-7(4-8)11(9)12/h2-3,7-12H,4-6H2,1H3,(H,15,16)
InChIKeyYKBVEMNSTCWBNI-UHFFFAOYSA-N
XLogP2.56
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.30
LogP ≤ 52.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid?
The IUPAC name of 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (CID 20695167) is 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.
What is the SMILES notation for 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid?
The canonical SMILES for 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid is CC1(C(=O)O)CC2CC1C1C3C=CC(C3)C21.
What is the InChIKey of 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid?
The InChIKey is YKBVEMNSTCWBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-14(13(15)16)6-9-5-10(14)12-8-3-2-7(4-8)11(9)12/h2-3,7-12H,4-6H2,1H3,(H,15,16).
What are the key properties of 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid?
4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid has a molecular weight of 218.30 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid is sourced from PubChem (CID 20695167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).