C11H18 — CID 20695287
(4E,8E)-7-methyldeca-1,4,8-triene (PubChem CID 20695287) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (4E,8E)-7-methyldeca-1,4,8-triene.
| Compound Name | (4E,8E)-7-methyldeca-1,4,8-triene |
|---|---|
| PubChem CID | 20695287 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (4E,8E)-7-methyldeca-1,4,8-triene |
| SMILES | C=CC/C=C/CC(C)/C=C/C |
| InChI | InChI=1S/C11H18/c1-4-6-7-8-10-11(3)9-5-2/h4-5,7-9,11H,1,6,10H2,2-3H3/b8-7+,9-5+ |
| InChIKey | JKXWMVWWQSSMOJ-DMQCZMPNSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|