About 4,6-diacetylpyran-2-one
4,6-diacetylpyran-2-one (PubChem CID 20695346) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 4,6-diacetylpyran-2-one.
Molecular Properties
| Compound Name | 4,6-diacetylpyran-2-one |
| PubChem CID | 20695346 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 4,6-diacetylpyran-2-one |
| SMILES | CC(=O)c1cc(C(C)=O)oc(=O)c1 |
| InChI | InChI=1S/C9H8O4/c1-5(10)7-3-8(6(2)11)13-9(12)4-7/h3-4H,1-2H3 |
| InChIKey | NAPQMSXKPPWGGI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-diacetylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diacetylpyran-2-one?
The IUPAC name of 4,6-diacetylpyran-2-one (CID 20695346) is 4,6-diacetylpyran-2-one.
What is the SMILES notation for 4,6-diacetylpyran-2-one?
The canonical SMILES for 4,6-diacetylpyran-2-one is CC(=O)c1cc(C(C)=O)oc(=O)c1.
What is the InChIKey of 4,6-diacetylpyran-2-one?
The InChIKey is NAPQMSXKPPWGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c1-5(10)7-3-8(6(2)11)13-9(12)4-7/h3-4H,1-2H3.
What are the key properties of 4,6-diacetylpyran-2-one?
4,6-diacetylpyran-2-one has a molecular weight of 180.16 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diacetylpyran-2-one is sourced from PubChem (CID 20695346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).