About 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol
2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol (PubChem CID 20695461) has the molecular formula C11H10F3NO
and a molecular weight of 229.20 g/mol. Its IUPAC name is 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol |
| PubChem CID | 20695461 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol |
| SMILES | CC#CC(O)(c1ccccc1N)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO/c1-2-7-10(16,11(12,13)14)8-5-3-4-6-9(8)15/h3-6,16H,15H2,1H3 |
| InChIKey | OUVRCRJMRXDECH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol?
The IUPAC name of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol (CID 20695461) is 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol.
What is the SMILES notation for 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol?
The canonical SMILES for 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol is CC#CC(O)(c1ccccc1N)C(F)(F)F.
What is the InChIKey of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol?
The InChIKey is OUVRCRJMRXDECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO/c1-2-7-10(16,11(12,13)14)8-5-3-4-6-9(8)15/h3-6,16H,15H2,1H3.
What are the key properties of 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol?
2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol has a molecular weight of 229.20 g/mol, XLogP of 2.04, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)-1,1,1-trifluoropent-3-yn-2-ol is sourced from PubChem (CID 20695461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).