C24H15F5N2OS — CID 20696223
N'-[diphenyl(thiophen-2-yl)methyl]-2,3,4,5,6-pentafluorobenzohydrazide (PubChem CID 20696223) has the molecular formula C24H15F5N2OS and a molecular weight of 474.45 g/mol. Its IUPAC name is N'-[diphenyl(thiophen-2-yl)methyl]-2,3,4,5,6-pentafluorobenzohydrazide.
| Compound Name | N'-[diphenyl(thiophen-2-yl)methyl]-2,3,4,5,6-pentafluorobenzohydrazide |
|---|---|
| PubChem CID | 20696223 |
| Molecular Formula | C24H15F5N2OS |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N'-[diphenyl(thiophen-2-yl)methyl]-2,3,4,5,6-pentafluorobenzohydrazide |
| SMILES | O=C(NNC(c1ccccc1)(c1ccccc1)c1cccs1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H15F5N2OS/c25-18-17(19(26)21(28)22(29)20(18)27)23(32)30-31-24(16-12-7-13-33-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13,31H,(H,30,32) |
| InChIKey | NDQWDSNYGRATAF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|