C19H23N5O4 — CID 20696356
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(2-phenylpropan-2-yloxymethyl)oxolane-3,4-diol (PubChem CID 20696356) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(2-phenylpropan-2-yloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(2-phenylpropan-2-yloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 20696356 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(2-phenylpropan-2-yloxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C19H23N5O4/c1-19(2,11-6-4-3-5-7-11)27-8-12-14(25)15(26)18(28-12)24-10-23-13-16(20)21-9-22-17(13)24/h3-7,9-10,12,14-15,18,25-26H,8H2,1-2H3,(H2,20,21,22)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | BQXWWDVKJFOOSA-SCFUHWHPSA-N |
| XLogP | 0.98 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |