About butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate
butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate (PubChem CID 20696710) has the molecular formula C21H38N2O5
and a molecular weight of 398.54 g/mol. Its IUPAC name is butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate |
| PubChem CID | 20696710 |
| Molecular Formula | C21H38N2O5 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate |
| SMILES | C=CCC(C(=O)NO)C(CC(C)C)C(=O)NC(CC(C)C)C(=O)OC(C)CC |
| InChI | InChI=1S/C21H38N2O5/c1-8-10-16(20(25)23-27)17(11-13(3)4)19(24)22-18(12-14(5)6)21(26)28-15(7)9-2/h8,13-18,27H,1,9-12H2,2-7H3,(H,22,24)(H,23,25) |
| InChIKey | JIZPXUHBQLQNPX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate?
The IUPAC name of butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate (CID 20696710) is butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate.
What is the SMILES notation for butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate?
The canonical SMILES for butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate is C=CCC(C(=O)NO)C(CC(C)C)C(=O)NC(CC(C)C)C(=O)OC(C)CC.
What is the InChIKey of butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate?
The InChIKey is JIZPXUHBQLQNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N2O5/c1-8-10-16(20(25)23-27)17(11-13(3)4)19(24)22-18(12-14(5)6)21(26)28-15(7)9-2/h8,13-18,27H,1,9-12H2,2-7H3,(H,22,24)(H,23,25).
What are the key properties of butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate?
butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate has a molecular weight of 398.54 g/mol, XLogP of 3.22, 13 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-4-methylpentanoate is sourced from PubChem (CID 20696710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).