C11H13NO3 — CID 20696780
1-(1,4-dimethylpyrrol-2-yl)pentane-1,3,4-trione (PubChem CID 20696780) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(1,4-dimethylpyrrol-2-yl)pentane-1,3,4-trione.
| Compound Name | 1-(1,4-dimethylpyrrol-2-yl)pentane-1,3,4-trione |
|---|---|
| PubChem CID | 20696780 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-(1,4-dimethylpyrrol-2-yl)pentane-1,3,4-trione |
| SMILES | CC(=O)C(=O)CC(=O)c1cc(C)cn1C |
| InChI | InChI=1S/C11H13NO3/c1-7-4-9(12(3)6-7)11(15)5-10(14)8(2)13/h4,6H,5H2,1-3H3 |
| InChIKey | VLNWTHQCQSWOJI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|