About (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate
(4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate (PubChem CID 20696848) has the molecular formula C18H14F2N2O2
and a molecular weight of 328.32 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate |
| PubChem CID | 20696848 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate |
| SMILES | O=C(OCc1ccc(F)cc1)c1cn(Cc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C18H14F2N2O2/c19-15-5-1-13(2-6-15)9-22-10-17(21-12-22)18(23)24-11-14-3-7-16(20)8-4-14/h1-8,10,12H,9,11H2 |
| InChIKey | FHEDZEFWTNVLHR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate?
The IUPAC name of (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate (CID 20696848) is (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate.
What is the SMILES notation for (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate?
The canonical SMILES for (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate is O=C(OCc1ccc(F)cc1)c1cn(Cc2ccc(F)cc2)cn1.
What is the InChIKey of (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate?
The InChIKey is FHEDZEFWTNVLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N2O2/c19-15-5-1-13(2-6-15)9-22-10-17(21-12-22)18(23)24-11-14-3-7-16(20)8-4-14/h1-8,10,12H,9,11H2.
What are the key properties of (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate?
(4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate has a molecular weight of 328.32 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 1-[(4-fluorophenyl)methyl]imidazole-4-carboxylate is sourced from PubChem (CID 20696848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).