C28H31N3O5 — CID 20697138
1-N,5-N-bis[2-(4-hydroxyphenyl)ethyl]-3-N-propan-2-ylbenzene-1,3,5-tricarboxamide (PubChem CID 20697138) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 1-N,5-N-bis[2-(4-hydroxyphenyl)ethyl]-3-N-propan-2-ylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,5-N-bis[2-(4-hydroxyphenyl)ethyl]-3-N-propan-2-ylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 20697138 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-N,5-N-bis[2-(4-hydroxyphenyl)ethyl]-3-N-propan-2-ylbenzene-1,3,5-tricarboxamide |
| SMILES | CC(C)NC(=O)c1cc(C(=O)NCCc2ccc(O)cc2)cc(C(=O)NCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C28H31N3O5/c1-18(2)31-28(36)23-16-21(26(34)29-13-11-19-3-7-24(32)8-4-19)15-22(17-23)27(35)30-14-12-20-5-9-25(33)10-6-20/h3-10,15-18,32-33H,11-14H2,1-2H3,(H,29,34)(H,30,35)(H,31,36) |
| InChIKey | JTAXBDUHOKPQEB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |