C24H40O4 — CID 20697410
[8-(3,5-dihydroxyheptyl)-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 20697410) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is [8-(3,5-dihydroxyheptyl)-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-(3,5-dihydroxyheptyl)-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 20697410 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | [8-(3,5-dihydroxyheptyl)-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(O)CC(O)CCC1C(C)C=CC2=CC(C)CC(OC(=O)C(C)CC)C21 |
| InChI | InChI=1S/C24H40O4/c1-6-16(4)24(27)28-22-13-15(3)12-18-9-8-17(5)21(23(18)22)11-10-20(26)14-19(25)7-2/h8-9,12,15-17,19-23,25-26H,6-7,10-11,13-14H2,1-5H3 |
| InChIKey | CZMXZZSSZDSKAD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |