C7H11F6N — CID 20697793
2,2,4,4,6,6-hexafluoroheptan-3-amine (PubChem CID 20697793) has the molecular formula C7H11F6N and a molecular weight of 223.16 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexafluoroheptan-3-amine.
| Compound Name | 2,2,4,4,6,6-hexafluoroheptan-3-amine |
|---|---|
| PubChem CID | 20697793 |
| Molecular Formula | C7H11F6N |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2,2,4,4,6,6-hexafluoroheptan-3-amine |
| SMILES | CC(F)(F)CC(F)(F)C(N)C(C)(F)F |
| InChI | InChI=1S/C7H11F6N/c1-5(8,9)3-7(12,13)4(14)6(2,10)11/h4H,3,14H2,1-2H3 |
| InChIKey | VPUCGKCAHIHHMA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |