C19H18FN3O2S — CID 20697797
6-[(6,6-dimethyl-5,7-dihydropyrrolo[1,2-c][1,3]thiazol-3-ylidene)amino]-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one (PubChem CID 20697797) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-[(6,6-dimethyl-5,7-dihydropyrrolo[1,2-c][1,3]thiazol-3-ylidene)amino]-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[(6,6-dimethyl-5,7-dihydropyrrolo[1,2-c][1,3]thiazol-3-ylidene)amino]-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 20697797 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 6-[(6,6-dimethyl-5,7-dihydropyrrolo[1,2-c][1,3]thiazol-3-ylidene)amino]-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)COc2cc(F)c(/N=c3\scc4n3CC(C)(C)C4)cc21 |
| InChI | InChI=1S/C19H18FN3O2S/c1-4-5-22-15-7-14(13(20)6-16(15)25-9-17(22)24)21-18-23-11-19(2,3)8-12(23)10-26-18/h1,6-7,10H,5,8-9,11H2,2-3H3/b21-18- |
| InChIKey | FUMSCCXMGBHZLC-UZYVYHOESA-N |
| XLogP | 2.86 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|