About dimethyl bis(2,2,2-trifluoroethyl) silicate
dimethyl bis(2,2,2-trifluoroethyl) silicate (PubChem CID 20697907) has the molecular formula C6H10F6O4Si
and a molecular weight of 288.22 g/mol. Its IUPAC name is dimethyl bis(2,2,2-trifluoroethyl) silicate.
Molecular Properties
| Compound Name | dimethyl bis(2,2,2-trifluoroethyl) silicate |
| PubChem CID | 20697907 |
| Molecular Formula | C6H10F6O4Si |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | dimethyl bis(2,2,2-trifluoroethyl) silicate |
| SMILES | CO[Si](OC)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C6H10F6O4Si/c1-13-17(14-2,15-3-5(7,8)9)16-4-6(10,11)12/h3-4H2,1-2H3 |
| InChIKey | SMFLFPKBAQQMLX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl bis(2,2,2-trifluoroethyl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl bis(2,2,2-trifluoroethyl) silicate?
The IUPAC name of dimethyl bis(2,2,2-trifluoroethyl) silicate (CID 20697907) is dimethyl bis(2,2,2-trifluoroethyl) silicate.
What is the SMILES notation for dimethyl bis(2,2,2-trifluoroethyl) silicate?
The canonical SMILES for dimethyl bis(2,2,2-trifluoroethyl) silicate is CO[Si](OC)(OCC(F)(F)F)OCC(F)(F)F.
What is the InChIKey of dimethyl bis(2,2,2-trifluoroethyl) silicate?
The InChIKey is SMFLFPKBAQQMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F6O4Si/c1-13-17(14-2,15-3-5(7,8)9)16-4-6(10,11)12/h3-4H2,1-2H3.
What are the key properties of dimethyl bis(2,2,2-trifluoroethyl) silicate?
dimethyl bis(2,2,2-trifluoroethyl) silicate has a molecular weight of 288.22 g/mol, XLogP of 1.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl bis(2,2,2-trifluoroethyl) silicate is sourced from PubChem (CID 20697907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).