About 4-propan-2-ylindol-2-one
4-propan-2-ylindol-2-one (PubChem CID 20698713) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is 4-propan-2-ylindol-2-one.
Molecular Properties
| Compound Name | 4-propan-2-ylindol-2-one |
| PubChem CID | 20698713 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 4-propan-2-ylindol-2-one |
| SMILES | CC(C)c1cccc2c1=CC(=O)N=2 |
| InChI | InChI=1S/C11H11NO/c1-7(2)8-4-3-5-10-9(8)6-11(13)12-10/h3-7H,1-2H3 |
| InChIKey | WNBATDARXUBARX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propan-2-ylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylindol-2-one?
The IUPAC name of 4-propan-2-ylindol-2-one (CID 20698713) is 4-propan-2-ylindol-2-one.
What is the SMILES notation for 4-propan-2-ylindol-2-one?
The canonical SMILES for 4-propan-2-ylindol-2-one is CC(C)c1cccc2c1=CC(=O)N=2.
What is the InChIKey of 4-propan-2-ylindol-2-one?
The InChIKey is WNBATDARXUBARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-7(2)8-4-3-5-10-9(8)6-11(13)12-10/h3-7H,1-2H3.
What are the key properties of 4-propan-2-ylindol-2-one?
4-propan-2-ylindol-2-one has a molecular weight of 173.22 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylindol-2-one is sourced from PubChem (CID 20698713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).