C8H9N3S — CID 20699443
5,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridine-2-thione (PubChem CID 20699443) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 5,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridine-2-thione.
| Compound Name | 5,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridine-2-thione |
|---|---|
| PubChem CID | 20699443 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 5,7-dimethyl-3H-[1,2,4]triazolo[1,5-a]pyridine-2-thione |
| SMILES | Cc1cc(C)n2[nH]c(=S)nc2c1 |
| InChI | InChI=1S/C8H9N3S/c1-5-3-6(2)11-7(4-5)9-8(12)10-11/h3-4H,1-2H3,(H,10,12) |
| InChIKey | HEKPGVRHVPFHIE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|