C5H11NOS — CID 20699545
(3-methyl-1,3-thiazolidin-2-yl)methanol (PubChem CID 20699545) has the molecular formula C5H11NOS and a molecular weight of 133.22 g/mol. Its IUPAC name is (3-methyl-1,3-thiazolidin-2-yl)methanol.
| Compound Name | (3-methyl-1,3-thiazolidin-2-yl)methanol |
|---|---|
| PubChem CID | 20699545 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | (3-methyl-1,3-thiazolidin-2-yl)methanol |
| SMILES | CN1CCSC1CO |
| InChI | InChI=1S/C5H11NOS/c1-6-2-3-8-5(6)4-7/h5,7H,2-4H2,1H3 |
| InChIKey | SLTYQGUZIZMIEZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |