C14H12F3NO2S — CID 20699699
methyl 2-[3-amino-4-phenyl-5-(trifluoromethyl)thiophen-2-yl]acetate (PubChem CID 20699699) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is methyl 2-[3-amino-4-phenyl-5-(trifluoromethyl)thiophen-2-yl]acetate.
| Compound Name | methyl 2-[3-amino-4-phenyl-5-(trifluoromethyl)thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 20699699 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 2-[3-amino-4-phenyl-5-(trifluoromethyl)thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1sc(C(F)(F)F)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C14H12F3NO2S/c1-20-10(19)7-9-12(18)11(8-5-3-2-4-6-8)13(21-9)14(15,16)17/h2-6H,7,18H2,1H3 |
| InChIKey | CNIQNMXVTQDUGS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |