C16H26 — CID 20700134
3-methyl-1-propyl-1,2,3,3a,4,4a,5,8,8a,8b-decahydrocyclopenta[a]indene (PubChem CID 20700134) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 3-methyl-1-propyl-1,2,3,3a,4,4a,5,8,8a,8b-decahydrocyclopenta[a]indene.
| Compound Name | 3-methyl-1-propyl-1,2,3,3a,4,4a,5,8,8a,8b-decahydrocyclopenta[a]indene |
|---|---|
| PubChem CID | 20700134 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3-methyl-1-propyl-1,2,3,3a,4,4a,5,8,8a,8b-decahydrocyclopenta[a]indene |
| SMILES | CCCC1CC(C)C2CC3CC=CCC3C12 |
| InChI | InChI=1S/C16H26/c1-3-6-13-9-11(2)15-10-12-7-4-5-8-14(12)16(13)15/h4-5,11-16H,3,6-10H2,1-2H3 |
| InChIKey | UXLDINSBWGVWDT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|