C17H32N5+ — CID 20700177
1,5,8,12-tetraza-15-azoniatricyclo[12.7.1.015,20]docosa-15(20),18-diene (PubChem CID 20700177) has the molecular formula C17H32N5+ and a molecular weight of 306.48 g/mol. Its IUPAC name is 1,5,8,12-tetraza-15-azoniatricyclo[12.7.1.015,20]docosa-15(20),18-diene.
| Compound Name | 1,5,8,12-tetraza-15-azoniatricyclo[12.7.1.015,20]docosa-15(20),18-diene |
|---|---|
| PubChem CID | 20700177 |
| Molecular Formula | C17H32N5+ |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 1,5,8,12-tetraza-15-azoniatricyclo[12.7.1.015,20]docosa-15(20),18-diene |
| SMILES | C1=CC2=[N+](CC1)C1CNCCCNCCNCCCN(C2)C1 |
| InChI | InChI=1S/C17H32N5/c1-2-12-22-16(5-1)14-21-11-4-8-19-10-9-18-6-3-7-20-13-17(22)15-21/h1,5,17-20H,2-4,6-15H2/q+1 |
| InChIKey | NUNGCBKNEBBXGP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 42.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|