C23H44O2Si2 — CID 20700488
4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopent-2-en-1-one (PubChem CID 20700488) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopent-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 20700488 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCCC/C=C(/CC1=CC(O[Si](C)(C)C(C)(C)C)CC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C23H44O2Si2/c1-10-11-12-13-14-15-21(26(5,6)7)17-19-16-20(18-22(19)24)25-27(8,9)23(2,3)4/h15-16,20H,10-14,17-18H2,1-9H3/b21-15- |
| InChIKey | PTRHNIJWYXBSBK-QNGOZBTKSA-N |
| XLogP | 7.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|