About carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate
carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate (PubChem CID 20700602) has the molecular formula C7H15N3O4S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate.
Molecular Properties
| Compound Name | carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate |
| PubChem CID | 20700602 |
| Molecular Formula | C7H15N3O4S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate |
| SMILES | NCCSSCCNC(=O)OCOC(N)=O |
| InChI | InChI=1S/C7H15N3O4S2/c8-1-3-15-16-4-2-10-7(12)14-5-13-6(9)11/h1-5,8H2,(H2,9,11)(H,10,12) |
| InChIKey | TUMVPRYINFILKF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate?
The IUPAC name of carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate (CID 20700602) is carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate.
What is the SMILES notation for carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate?
The canonical SMILES for carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate is NCCSSCCNC(=O)OCOC(N)=O.
What is the InChIKey of carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate?
The InChIKey is TUMVPRYINFILKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O4S2/c8-1-3-15-16-4-2-10-7(12)14-5-13-6(9)11/h1-5,8H2,(H2,9,11)(H,10,12).
What are the key properties of carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate?
carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate has a molecular weight of 269.35 g/mol, XLogP of 0.11, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyloxymethyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate is sourced from PubChem (CID 20700602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).