C15H22N4O3 — CID 20700642
N,N'-bis(2-aminoethyl)-2-[(4-formylphenyl)methyl]propanediamide (PubChem CID 20700642) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N,N'-bis(2-aminoethyl)-2-[(4-formylphenyl)methyl]propanediamide.
| Compound Name | N,N'-bis(2-aminoethyl)-2-[(4-formylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 20700642 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N,N'-bis(2-aminoethyl)-2-[(4-formylphenyl)methyl]propanediamide |
| SMILES | NCCNC(=O)C(Cc1ccc(C=O)cc1)C(=O)NCCN |
| InChI | InChI=1S/C15H22N4O3/c16-5-7-18-14(21)13(15(22)19-8-6-17)9-11-1-3-12(10-20)4-2-11/h1-4,10,13H,5-9,16-17H2,(H,18,21)(H,19,22) |
| InChIKey | PMRGQOGEAXBFAA-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|