C8H8F8O — CID 20700672
3-(1,1-difluoroethyl)-2,2,3,4,4,6-hexafluoro-6-methyloxane (PubChem CID 20700672) has the molecular formula C8H8F8O and a molecular weight of 272.13 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-2,2,3,4,4,6-hexafluoro-6-methyloxane.
| Compound Name | 3-(1,1-difluoroethyl)-2,2,3,4,4,6-hexafluoro-6-methyloxane |
|---|---|
| PubChem CID | 20700672 |
| Molecular Formula | C8H8F8O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-(1,1-difluoroethyl)-2,2,3,4,4,6-hexafluoro-6-methyloxane |
| SMILES | CC1(F)CC(F)(F)C(F)(C(C)(F)F)C(F)(F)O1 |
| InChI | InChI=1S/C8H8F8O/c1-4(9)3-6(12,13)7(14,5(2,10)11)8(15,16)17-4/h3H2,1-2H3 |
| InChIKey | WGBXRVZZTOLWDY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |