About 6-methoxy-1H-naphthalen-1-ide;thorium
6-methoxy-1H-naphthalen-1-ide;thorium (PubChem CID 20700698) has the molecular formula C11H9OTh2-
and a molecular weight of 621.27 g/mol. Its IUPAC name is 6-methoxy-1H-naphthalen-1-ide;thorium.
Molecular Properties
| Compound Name | 6-methoxy-1H-naphthalen-1-ide;thorium |
| PubChem CID | 20700698 |
| Molecular Formula | C11H9OTh2- |
| Molecular Weight | 621.27 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | 6-methoxy-1H-naphthalen-1-ide;thorium |
| SMILES | COc1ccc2[c-]cccc2c1.[Th].[Th] |
| InChI | InChI=1S/C11H9O.2Th/c1-12-11-7-6-9-4-2-3-5-10(9)8-11;;/h2-3,5-8H,1H3;;/q-1;; |
| InChIKey | OZQMCDISEBIPMW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 621.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-1H-naphthalen-1-ide;thorium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1H-naphthalen-1-ide;thorium?
The IUPAC name of 6-methoxy-1H-naphthalen-1-ide;thorium (CID 20700698) is 6-methoxy-1H-naphthalen-1-ide;thorium.
What is the SMILES notation for 6-methoxy-1H-naphthalen-1-ide;thorium?
The canonical SMILES for 6-methoxy-1H-naphthalen-1-ide;thorium is COc1ccc2[c-]cccc2c1.[Th].[Th].
What is the InChIKey of 6-methoxy-1H-naphthalen-1-ide;thorium?
The InChIKey is OZQMCDISEBIPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9O.2Th/c1-12-11-7-6-9-4-2-3-5-10(9)8-11;;/h2-3,5-8H,1H3;;/q-1;;.
What are the key properties of 6-methoxy-1H-naphthalen-1-ide;thorium?
6-methoxy-1H-naphthalen-1-ide;thorium has a molecular weight of 621.27 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1H-naphthalen-1-ide;thorium is sourced from PubChem (CID 20700698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).