C12H17N — CID 20700832
(2E)-2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trienylidene]-1-methylaziridine (PubChem CID 20700832) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trienylidene]-1-methylaziridine.
| Compound Name | (2E)-2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trienylidene]-1-methylaziridine |
|---|---|
| PubChem CID | 20700832 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2E)-2-[(2E,4E)-5,6-dimethylhepta-2,4,6-trienylidene]-1-methylaziridine |
| SMILES | C=C(C)/C(C)=C/C=C/C=C1\CN1C |
| InChI | InChI=1S/C12H17N/c1-10(2)11(3)7-5-6-8-12-9-13(12)4/h5-8H,1,9H2,2-4H3/b6-5+,11-7+,12-8+ |
| InChIKey | BYPYGKPIHDJOFY-SZKUKKIJSA-N |
| XLogP | 2.89 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|