About 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene
1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene (PubChem CID 20700913) has the molecular formula C5H6N+
and a molecular weight of 80.11 g/mol. Its IUPAC name is 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene.
Molecular Properties
| Compound Name | 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene |
| PubChem CID | 20700913 |
| Molecular Formula | C5H6N+ |
| Molecular Weight | 80.11 g/mol |
| Exact Mass | 80.05 |
| IUPAC Name | 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene |
| SMILES | C[N+]12C=CC1=C2 |
| InChI | InChI=1S/C5H6N/c1-6-3-2-5(6)4-6/h2-4H,1H3/q+1 |
| InChIKey | GUNKUPGXDSUCJX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.11 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene?
The IUPAC name of 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene (CID 20700913) is 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene.
What is the SMILES notation for 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene?
The canonical SMILES for 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene is C[N+]12C=CC1=C2.
What is the InChIKey of 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene?
The InChIKey is GUNKUPGXDSUCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N/c1-6-3-2-5(6)4-6/h2-4H,1H3/q+1.
What are the key properties of 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene?
1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene has a molecular weight of 80.11 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-azoniabicyclo[2.1.0]penta-2,4-diene is sourced from PubChem (CID 20700913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).