C14H23FN4 — CID 20701261
2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-5-fluoropyrimidine (PubChem CID 20701261) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-5-fluoropyrimidine.
| Compound Name | 2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-5-fluoropyrimidine |
|---|---|
| PubChem CID | 20701261 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[4-(3,3-dimethylbutyl)piperazin-1-yl]-5-fluoropyrimidine |
| SMILES | CC(C)(C)CCN1CCN(c2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C14H23FN4/c1-14(2,3)4-5-18-6-8-19(9-7-18)13-16-10-12(15)11-17-13/h10-11H,4-9H2,1-3H3 |
| InChIKey | FMWGRLOFBMPTPO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |