C23H34O — CID 20701554
2-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-5-methoxy-1,3,3-trimethylcyclohexene (PubChem CID 20701554) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-5-methoxy-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-5-methoxy-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 20701554 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-5-methoxy-1,3,3-trimethylcyclohexene |
| SMILES | C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CC(OC)CC1(C)C |
| InChI | InChI=1S/C23H34O/c1-8-9-11-18(2)12-10-13-19(3)14-15-22-20(4)16-21(24-7)17-23(22,5)6/h8-15,21H,16-17H2,1-7H3/b9-8+,12-10+,15-14+,18-11+,19-13+ |
| InChIKey | UVQSSHBMEJTLLF-ZBOAPWKKSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|