About N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron
N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron (PubChem CID 20702003) has the molecular formula C20H24Cl2FeN2O
and a molecular weight of 435.18 g/mol. Its IUPAC name is N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron.
Molecular Properties
| Compound Name | N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron |
| PubChem CID | 20702003 |
| Molecular Formula | C20H24Cl2FeN2O |
| Molecular Weight | 435.18 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron |
| SMILES | C/C(=N\c1ccccc1)c1ccc(/C(C)=N/C2CCCCC2)o1.Cl[Fe]Cl |
| InChI | InChI=1S/C20H24N2O.2ClH.Fe/c1-15(21-17-9-5-3-6-10-17)19-13-14-20(23-19)16(2)22-18-11-7-4-8-12-18;;;/h3,5-6,9-10,13-14,18H,4,7-8,11-12H2,1-2H3;2*1H;/q;;;+2/p-2/b21-15+,22-16+;;; |
| InChIKey | SNZARDYHRJGEGA-HESHWDSWSA-L |
| XLogP | 6.94 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.18 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron?
The IUPAC name of N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron (CID 20702003) is N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron.
What is the SMILES notation for N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron?
The canonical SMILES for N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron is C/C(=N\c1ccccc1)c1ccc(/C(C)=N/C2CCCCC2)o1.Cl[Fe]Cl.
What is the InChIKey of N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron?
The InChIKey is SNZARDYHRJGEGA-HESHWDSWSA-L. The full InChI is InChI=1S/C20H24N2O.2ClH.Fe/c1-15(21-17-9-5-3-6-10-17)19-13-14-20(23-19)16(2)22-18-11-7-4-8-12-18;;;/h3,5-6,9-10,13-14,18H,4,7-8,11-12H2,1-2H3;2*1H;/q;;;+2/p-2/b21-15+,22-16+;;;.
What are the key properties of N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron?
N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron has a molecular weight of 435.18 g/mol, XLogP of 6.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine;dichloroiron is sourced from PubChem (CID 20702003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).