About dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine
dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine (PubChem CID 20702065) has the molecular formula C19H16Cl2FeN2O
and a molecular weight of 415.10 g/mol. Its IUPAC name is dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine.
Molecular Properties
| Compound Name | dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine |
| PubChem CID | 20702065 |
| Molecular Formula | C19H16Cl2FeN2O |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine |
| SMILES | Cc1ccc(/N=C/c2ccc(/C=N/c3ccccc3)o2)cc1.Cl[Fe]Cl |
| InChI | InChI=1S/C19H16N2O.2ClH.Fe/c1-15-7-9-17(10-8-15)21-14-19-12-11-18(22-19)13-20-16-5-3-2-4-6-16;;;/h2-14H,1H3;2*1H;/q;;;+2/p-2/b20-13+,21-14+;;; |
| InChIKey | FGRIBMDQZWKSLU-YXWHRVGSSA-L |
| XLogP | 6.47 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine?
The IUPAC name of dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine (CID 20702065) is dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine.
What is the SMILES notation for dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine?
The canonical SMILES for dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine is Cc1ccc(/N=C/c2ccc(/C=N/c3ccccc3)o2)cc1.Cl[Fe]Cl.
What is the InChIKey of dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine?
The InChIKey is FGRIBMDQZWKSLU-YXWHRVGSSA-L. The full InChI is InChI=1S/C19H16N2O.2ClH.Fe/c1-15-7-9-17(10-8-15)21-14-19-12-11-18(22-19)13-20-16-5-3-2-4-6-16;;;/h2-14H,1H3;2*1H;/q;;;+2/p-2/b20-13+,21-14+;;;.
What are the key properties of dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine?
dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine has a molecular weight of 415.10 g/mol, XLogP of 6.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;1-[5-[(4-methylphenyl)iminomethyl]furan-2-yl]-N-phenylmethanimine is sourced from PubChem (CID 20702065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).