C34H31N4O7S- — CID 20702767
[6-[(3E)-3-(2,2-diethyl-1H-perimidin-6-ylidene)-2-hydroxy-4,5-dioxocyclopenten-1-yl]-2-ethyl-1,3-dihydroperimidin-2-yl]methyl sulfate (PubChem CID 20702767) has the molecular formula C34H31N4O7S- and a molecular weight of 639.71 g/mol. Its IUPAC name is [6-[(3E)-3-(2,2-diethyl-1H-perimidin-6-ylidene)-2-hydroxy-4,5-dioxocyclopenten-1-yl]-2-ethyl-1,3-dihydroperimidin-2-yl]methyl sulfate.
| Compound Name | [6-[(3E)-3-(2,2-diethyl-1H-perimidin-6-ylidene)-2-hydroxy-4,5-dioxocyclopenten-1-yl]-2-ethyl-1,3-dihydroperimidin-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 20702767 |
| Molecular Formula | C34H31N4O7S- |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | [6-[(3E)-3-(2,2-diethyl-1H-perimidin-6-ylidene)-2-hydroxy-4,5-dioxocyclopenten-1-yl]-2-ethyl-1,3-dihydroperimidin-2-yl]methyl sulfate |
| SMILES | CCC1(CC)N=c2cc/c(=C3\C(=O)C(=O)C(c4ccc5c6c(cccc46)NC(CC)(COS(=O)(=O)[O-])N5)=C3O)c3cccc(c23)N1 |
| InChI | InChI=1S/C34H32N4O7S/c1-4-33(5-2)35-22-11-7-9-18-20(13-15-24(36-33)26(18)22)28-30(39)29(32(41)31(28)40)21-14-16-25-27-19(21)10-8-12-23(27)37-34(6-3,38-25)17-45-46(42,43)44/h7-16,35,37-39H,4-6,17H2,1-3H3,(H,42,43,44)/p-1/b28-20+ |
| InChIKey | MVDRCLWFZNCAPZ-VFCFBJKWSA-M |
| XLogP | 4.25 |
| TPSA | 169.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|