About CID 20702785
CID 20702785 (PubChem CID 20702785) has the molecular formula C36H18BN6O9S3+2
and a molecular weight of 785.59 g/mol.
Molecular Properties
| Compound Name | CID 20702785 |
| PubChem CID | 20702785 |
| Molecular Formula | C36H18BN6O9S3+2 |
| Molecular Weight | 785.59 g/mol |
| Exact Mass | 785.04 |
| IUPAC Name | — |
| SMILES | O=S(O)Oc1ccc2cc3c(cc2c1)/C1=N/C2=[N+]4[B][N+]5=C(N=C4c4cc6ccc(S(=O)(=O)O)cc6cc42)c2cc4cc(S(=O)(=O)O)ccc4cc2/C5=N/C3=N1 |
| InChI | InChI=1S/C36H18BN6O9S3/c44-53(45)52-22-4-1-16-10-25-26(13-19(16)7-22)32-38-31(25)39-33-27-11-17-2-5-24(55(49,50)51)9-21(17)15-30(27)36-41-35-28-12-18-3-6-23(54(46,47)48)8-20(18)14-29(28)34(40-32)43(35)37-42(33)36/h1-15H,(H,44,45)(H,46,47,48)(H,49,50,51)/q+2 |
| InChIKey | SARCHOPAFJGQQO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 210.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 785.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 20702785 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20702785?
The IUPAC name of CID 20702785 (CID 20702785) is not available.
What is the SMILES notation for CID 20702785?
The canonical SMILES for CID 20702785 is O=S(O)Oc1ccc2cc3c(cc2c1)/C1=N/C2=[N+]4[B][N+]5=C(N=C4c4cc6ccc(S(=O)(=O)O)cc6cc42)c2cc4cc(S(=O)(=O)O)ccc4cc2/C5=N/C3=N1.
What is the InChIKey of CID 20702785?
The InChIKey is SARCHOPAFJGQQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H18BN6O9S3/c44-53(45)52-22-4-1-16-10-25-26(13-19(16)7-22)32-38-31(25)39-33-27-11-17-2-5-24(55(49,50)51)9-21(17)15-30(27)36-41-35-28-12-18-3-6-23(54(46,47)48)8-20(18)14-29(28)34(40-32)43(35)37-42(33)36/h1-15H,(H,44,45)(H,46,47,48)(H,49,50,51)/q+2.
What are the key properties of CID 20702785?
CID 20702785 has a molecular weight of 785.59 g/mol, XLogP of 3.66, 4 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20702785 is sourced from PubChem (CID 20702785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).