About 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate
2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate (PubChem CID 20702863) has the molecular formula C28H30N2O4S
and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate |
| PubChem CID | 20702863 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCc1ccc2c(OC(=O)C(C)(C)C)c(-c3cnc4ccccc4n3)sc2c1 |
| InChI | InChI=1S/C28H30N2O4S/c1-6-17(2)26(31)33-14-13-18-11-12-19-23(15-18)35-25(24(19)34-27(32)28(3,4)5)22-16-29-20-9-7-8-10-21(20)30-22/h7-12,15-17H,6,13-14H2,1-5H3 |
| InChIKey | ZBXCWVBHSVFLOW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate?
The IUPAC name of 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate (CID 20702863) is 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate.
What is the SMILES notation for 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate?
The canonical SMILES for 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate is CCC(C)C(=O)OCCc1ccc2c(OC(=O)C(C)(C)C)c(-c3cnc4ccccc4n3)sc2c1.
What is the InChIKey of 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate?
The InChIKey is ZBXCWVBHSVFLOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O4S/c1-6-17(2)26(31)33-14-13-18-11-12-19-23(15-18)35-25(24(19)34-27(32)28(3,4)5)22-16-29-20-9-7-8-10-21(20)30-22/h7-12,15-17H,6,13-14H2,1-5H3.
What are the key properties of 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate?
2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate has a molecular weight of 490.63 g/mol, XLogP of 6.59, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2-dimethylpropanoyloxy)-2-quinoxalin-2-yl-1-benzothiophen-6-yl]ethyl 2-methylbutanoate is sourced from PubChem (CID 20702863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).