C11H11N5 — CID 20703308
4,5,8-trimethyl-3,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaene (PubChem CID 20703308) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4,5,8-trimethyl-3,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaene.
| Compound Name | 4,5,8-trimethyl-3,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaene |
|---|---|
| PubChem CID | 20703308 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4,5,8-trimethyl-3,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,7,9,11-hexaene |
| SMILES | Cc1nc2c(nc(C)n2C)c2cnncc12 |
| InChI | InChI=1S/C11H11N5/c1-6-8-4-12-13-5-9(8)10-11(14-6)16(3)7(2)15-10/h4-5H,1-3H3 |
| InChIKey | LLFBYPHNCDJEHE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |