C23H25N7O3 — CID 20703341
1-[13-(1,3-benzodioxol-5-ylmethylamino)-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]piperidin-4-ol (PubChem CID 20703341) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[13-(1,3-benzodioxol-5-ylmethylamino)-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]piperidin-4-ol.
| Compound Name | 1-[13-(1,3-benzodioxol-5-ylmethylamino)-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 20703341 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[13-(1,3-benzodioxol-5-ylmethylamino)-5-ethyl-4,5,7,11,12-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-10-yl]piperidin-4-ol |
| SMILES | CCn1ncc2c3c(NCc4ccc5c(c4)OCO5)nnc(N4CCC(O)CC4)c3cnc21 |
| InChI | InChI=1S/C23H25N7O3/c1-2-30-22-17(12-26-30)20-16(11-25-22)23(29-7-5-15(31)6-8-29)28-27-21(20)24-10-14-3-4-18-19(9-14)33-13-32-18/h3-4,9,11-12,15,31H,2,5-8,10,13H2,1H3,(H,24,27) |
| InChIKey | ZTGHFIVCJDJJDG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |